ChemNet > CAS > 68837-59-2 4-Bromo-2-methylbenzoic acid
68837-59-2 4-Bromo-2-methylbenzoic acid
| Nazwa produktu: |
4-Bromo-2-methylbenzoic acid |
| Synonimy |
2-Methyl-4-Bromobenzoic acid; RARECHEM AL BO 0455; 4-Bromo-o-toluic acid |
| MF |
C8H7BrO2 |
| Masie cząsteczkowej |
215.044 |
| InChI |
InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Nr CAS |
68837-59-2 |
| EINECS |
272-437-7 |
| Struktury molekularnej |
|
| Gęstość |
1.599g/cm3 |
| Temperatura topnienia |
180-184℃ |
| Temperatura wrzenia |
310.1°C at 760 mmHg |
| Współczynnik załamania |
1.595 |
| Temperatura zapłonu |
141.3°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R22:;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
