ChemNet > CAS > 69614-95-5 4-(2-Chloroethyl)acetophenone
69614-95-5 4-(2-Chloroethyl)acetophenone
Nazwa produktu: |
4-(2-Chloroethyl)acetophenone |
Synonimy |
4'-(beta-Chloroethyl)acetophenone; 1-[4-(2-chloroethyl)phenyl]ethanone |
MF |
C10H11ClO |
Masie cząsteczkowej |
182.6467 |
InChI |
InChI=1/C10H11ClO/c1-8(12)10-4-2-9(3-5-10)6-7-11/h2-5H,6-7H2,1H3 |
Nr CAS |
69614-95-5 |
Struktury molekularnej |
|
Gęstość |
1.105g/cm3 |
Temperatura wrzenia |
297°C at 760 mmHg |
Współczynnik załamania |
1.525 |
Temperatura zapłonu |
149.8°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|