ChemNet > CAS > 7145-82-6 2,4,6-Trichloroiodobenzene
7145-82-6 2,4,6-Trichloroiodobenzene
| Nazwa produktu: |
2,4,6-Trichloroiodobenzene |
| Synonimy |
2,4,5-Trichloroiodobenzene; 1-Iodo-2,4,5-trichlorobenzene; 1,2,4-trichloro-5-iodobenzene |
| MF |
C6H2Cl3I |
| Masie cząsteczkowej |
307.3435 |
| InChI |
InChI=1/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| Nr CAS |
7145-82-6 |
| Struktury molekularnej |
|
| Gęstość |
2.085g/cm3 |
| Temperatura topnienia |
56-58℃ |
| Temperatura wrzenia |
292.8°C at 760 mmHg |
| Współczynnik załamania |
1.651 |
| Temperatura zapłonu |
130.9°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
