ChemNet > CAS > 72235-56-4 3-Chloro-4-fluorobenzylamine
72235-56-4 3-Chloro-4-fluorobenzylamine
Nazwa produktu: |
3-Chloro-4-fluorobenzylamine |
Synonimy |
1-(3-chloro-4-fluorophenyl)methanamine; 1-{4-[(4-fluorobenzyl)oxy]phenyl}ethanone; 3-Chloro-4-fluorobenzyl amine |
MF |
C15H13FO2 |
Masie cząsteczkowej |
244.2609 |
InChI |
InChI=1/C15H13FO2/c1-11(17)13-4-8-15(9-5-13)18-10-12-2-6-14(16)7-3-12/h2-9H,10H2,1H3 |
Nr CAS |
72235-56-4 |
Struktury molekularnej |
|
Gęstość |
1.163g/cm3 |
Temperatura wrzenia |
382.9°C at 760 mmHg |
Współczynnik załamania |
1.555 |
Temperatura zapłonu |
179°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|