ChemNet > CAS > 813-56-9 Malonic-d2 acid-d2
813-56-9 Malonic-d2 acid-d2
Nazwa produktu: |
Malonic-d2 acid-d2 |
Synonimy |
Malonic acid-d4; (~2~H_2_)propane(~2~H_2_)dioic acid |
MF |
C3D4O4 |
Masie cząsteczkowej |
108.0861 |
InChI |
InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
Nr CAS |
813-56-9 |
EINECS |
212-385-4 |
Struktury molekularnej |
|
Gęstość |
1.605g/cm3 |
Temperatura topnienia |
130-132℃ |
Temperatura wrzenia |
386.8°C at 760 mmHg |
Współczynnik załamania |
1.478 |
Temperatura zapłonu |
201.9°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|