ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
Nazwa produktu: |
Methyl 3-methylthiophene-2-carboxylate |
Synonimy |
3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
MF |
C7H8O2S |
Masie cząsteczkowej |
156.2022 |
InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
Nr CAS |
81452-54-2 |
Struktury molekularnej |
|
Gęstość |
1.173g/cm3 |
Temperatura wrzenia |
211°C at 760 mmHg |
Współczynnik załamania |
1.531 |
Temperatura zapłonu |
81.4°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|