ChemNet > CAS > 81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
81633-29-6 ethyl 2-amino-4-methylpyrimidine-5-carboxylate
Nazwa produktu: |
ethyl 2-amino-4-methylpyrimidine-5-carboxylate |
MF |
C8H11N3O2 |
Masie cząsteczkowej |
181.1918 |
InChI |
InChI=1/C8H11N3O2/c1-3-13-7(12)6-4-10-8(9)11-5(6)2/h4H,3H2,1-2H3,(H2,9,10,11) |
Nr CAS |
81633-29-6 |
Struktury molekularnej |
|
Gęstość |
1.217g/cm3 |
Temperatura topnienia |
220℃ |
Temperatura wrzenia |
350.5°C at 760 mmHg |
Współczynnik załamania |
1.556 |
Temperatura zapłonu |
165.8°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|