ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
Nazwa produktu: |
3-chloro-4-fluorophenylhydrazine |
MF |
C6H6ClFN2 |
Masie cząsteczkowej |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
Nr CAS |
84282-78-0 |
Struktury molekularnej |
|
Gęstość |
1.43g/cm3 |
Temperatura topnienia |
62-63℃ |
Temperatura wrzenia |
253.1°C at 760 mmHg |
Współczynnik załamania |
1.624 |
Temperatura zapłonu |
106.9°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|