ChemNet > CAS > 853-39-4 Decafluorobenzophenone
853-39-4 Decafluorobenzophenone
Nazwa produktu: |
Decafluorobenzophenone |
MF |
C13F10O |
Masie cząsteczkowej |
362.12 |
InChI |
InChI=1/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
Nr CAS |
853-39-4 |
EINECS |
212-717-8 |
Struktury molekularnej |
|
Temperatura topnienia |
92-94℃ |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|