ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
| Nazwa produktu: |
2-Methoxybiphenyl |
| Synonimy |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| MF |
C13H12O |
| Masie cząsteczkowej |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| Nr CAS |
86-26-0 |
| EINECS |
201-659-9 |
| Struktury molekularnej |
|
| Gęstość |
1.03g/cm3 |
| Temperatura topnienia |
30-33℃ |
| Temperatura wrzenia |
274°C at 760 mmHg |
| Współczynnik załamania |
1.556 |
| Temperatura zapłonu |
101.3°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R33:Danger of cummulative effects.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
