ChemNet > CAS > 88-86-8 2,5-dichloro-3-nitrobenzoic acid
88-86-8 2,5-dichloro-3-nitrobenzoic acid
Nazwa produktu: |
2,5-dichloro-3-nitrobenzoic acid |
Synonimy |
Benzoic acid, 2,5-dichloro-3-nitro-; 2,5-Dichloro-3-nitrobenzoic acid; 2,5-Dichloro-4-nitrobenzoic acid; 2-09-00-00276 (Beilstein Handbook Reference); 3-Nitro-2,5-dichlorobenzoic acid; BRN 1976119; Caswell No. 312; Dinoben; EPA Pesticide Chemical Code 028101; Kyselina 2,5-dichlor-3-nitrobenzoova; Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
MF |
C7H3Cl2NO4 |
Masie cząsteczkowej |
236.009 |
InChI |
InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
Nr CAS |
88-86-8 |
EINECS |
201-862-2 |
Struktury molekularnej |
|
Gęstość |
1.713g/cm3 |
Temperatura topnienia |
216-220℃ |
Temperatura wrzenia |
366.5°C at 760 mmHg |
Współczynnik załamania |
1.638 |
Temperatura zapłonu |
175.5°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|