ChemNet > CAS > 90064-46-3 1-Chloro-4-iodo-2,5-dimethoxy-benzene
90064-46-3 1-Chloro-4-iodo-2,5-dimethoxy-benzene
Nazwa produktu: |
1-Chloro-4-iodo-2,5-dimethoxy-benzene |
Synonimy |
1-Chloro-4-iodo-2,5-dimethoxybenzene |
MF |
C8H8ClIO2 |
Masie cząsteczkowej |
298.5054 |
InChI |
InChI=1/C8H8ClIO2/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4H,1-2H3 |
Nr CAS |
90064-46-3 |
Struktury molekularnej |
|
Gęstość |
1.74g/cm3 |
Temperatura topnienia |
115℃ |
Temperatura wrzenia |
324.8°C at 760 mmHg |
Współczynnik załamania |
1.584 |
Temperatura zapłonu |
150.2°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|