ChemNet > CAS > 92-24-0 2,3-Benzanthracene
92-24-0 2,3-Benzanthracene
| Nazwa produktu: |
2,3-Benzanthracene |
| Synonimy |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
| MF |
C18H12 |
| Masie cząsteczkowej |
228.2879 |
| InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| Nr CAS |
92-24-0 |
| EINECS |
202-138-9 |
| Struktury molekularnej |
|
| Gęstość |
1.19g/cm3 |
| Temperatura topnienia |
300℃ |
| Temperatura wrzenia |
436.7°C at 760 mmHg |
| Współczynnik załamania |
1.771 |
| Temperatura zapłonu |
209.1°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R40:Possible risks of irreversible effects.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
