ChemNet > CAS > 933-78-8 2,3,5-Trichlorophenol
933-78-8 2,3,5-Trichlorophenol
Nazwa produktu: |
2,3,5-Trichlorophenol |
MF |
C6H3Cl3O |
Masie cząsteczkowej |
197.4464 |
InChI |
InChI=1/C6H3Cl3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
Nr CAS |
933-78-8 |
EINECS |
213-272-2 |
Struktury molekularnej |
|
Gęstość |
1.596g/cm3 |
Temperatura topnienia |
57-60℃ |
Temperatura wrzenia |
250.2°C at 760 mmHg |
Współczynnik załamania |
1.608 |
Temperatura zapłonu |
105.1°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|