ChemNet > CAS > 104-66-5 1,2-Diphenoxyethane
104-66-5 1,2-Diphenoxyethane
| Nome do produto |
1,2-Diphenoxyethane |
| Sinônimos |
Ethylene glycol diphenyl ether; 1,1'-[ethane-1,2-diylbis(oxy)]dibenzene; 1,2-Diphenoxy ethane |
| Fórmula molecular |
C14H14O2 |
| Peso Molecular |
214.2598 |
| InChI |
InChI=1/C14H14O2/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| CAS Registry Number |
104-66-5 |
| EINECS |
203-224-9 |
| Estrutura Molecular |
|
| Densidade |
1.08g/cm3 |
| Ponto de fusão |
95-98℃ |
| Ponto de ebulição |
341.6°C at 760 mmHg |
| índice de refração |
1.556 |
| O ponto de inflamação |
139.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
