ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
| Nome do produto |
2,6-Dibromo-4-nitrotoluene |
| Sinônimos |
1,3-dibromo-2-methyl-5-nitrobenzene |
| Fórmula molecular |
C7H5Br2NO2 |
| Peso Molecular |
294.9281 |
| InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
| CAS Registry Number |
110127-07-6 |
| Estrutura Molecular |
|
| Densidade |
1.967g/cm3 |
| Ponto de ebulição |
320.4°C at 760 mmHg |
| índice de refração |
1.625 |
| O ponto de inflamação |
147.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
