ChemNet > CAS > 1124-39-6 4-Ethylcatechol
1124-39-6 4-Ethylcatechol
| Nome do produto |
4-Ethylcatechol |
| Sinônimos |
3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
| Fórmula molecular |
C8H10O2 |
| Peso Molecular |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
| CAS Registry Number |
1124-39-6 |
| EINECS |
214-397-5 |
| Estrutura Molecular |
|
| Densidade |
1.159g/cm3 |
| Ponto de ebulição |
273.3°C at 760 mmHg |
| índice de refração |
1.578 |
| O ponto de inflamação |
134.1°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
