ChemNet > CAS > 117-12-4 1,5-dihydroxyanthraquinone
117-12-4 1,5-dihydroxyanthraquinone
| Nome do produto |
1,5-dihydroxyanthraquinone |
| Sinônimos |
Anthrarufin,80%; 9,10-Anthracenedione, 1,5-dihydroxy-; ANTHRARUFIN; 1,5-dihydroxyanthracene-9,10-dione |
| Fórmula molecular |
C14H8O4 |
| Peso Molecular |
240.2109 |
| InChI |
InChI=1/C14H8O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-16H |
| CAS Registry Number |
117-12-4 |
| EINECS |
204-175-6 |
| Estrutura Molecular |
|
| Densidade |
1.54g/cm3 |
| Ponto de fusão |
268-273℃ |
| Ponto de ebulição |
452.7°C at 760 mmHg |
| índice de refração |
1.732 |
| O ponto de inflamação |
241.7°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
