ChemNet > CAS > 135-01-3 1,2-diethylbenzene
135-01-3 1,2-diethylbenzene
| Nome do produto |
1,2-diethylbenzene |
| Sinônimos |
Diethylbenzene; o-Diethylbenzene |
| Fórmula molecular |
C10H14 |
| Peso Molecular |
134.2182 |
| InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
135-01-3 |
| EINECS |
205-170-1 |
| Estrutura Molecular |
|
| Densidade |
0.865g/cm3 |
| Ponto de ebulição |
183.5°C at 760 mmHg |
| índice de refração |
1.496 |
| O ponto de inflamação |
49.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
