ChemNet > CAS > 139669-95-7 2,4-Dibromo-thiazole-5-carbaldehyde
139669-95-7 2,4-Dibromo-thiazole-5-carbaldehyde
| Nome do produto |
2,4-Dibromo-thiazole-5-carbaldehyde |
| Sinônimos |
2,4-dibromo-1,3-thiazole-5-carbaldehyde |
| Fórmula molecular |
C4HBr2NOS |
| Peso Molecular |
270.9298 |
| InChI |
InChI=1/C4HBr2NOS/c5-3-2(1-8)9-4(6)7-3/h1H |
| CAS Registry Number |
139669-95-7 |
| Estrutura Molecular |
|
| Densidade |
2.332g/cm3 |
| Ponto de fusão |
99.8℃ |
| Ponto de ebulição |
317°C at 760 mmHg |
| índice de refração |
1.699 |
| O ponto de inflamação |
145.5°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
