ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
| Nome do produto |
3,5-Dibromo-4-methylphenol |
| Sinônimos |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| Fórmula molecular |
C7H6Br2O |
| Peso Molecular |
265.9299 |
| InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| CAS Registry Number |
13979-81-2 |
| EINECS |
237-763-6 |
| Estrutura Molecular |
|
| Densidade |
1.948g/cm3 |
| Ponto de ebulição |
293.1°C at 760 mmHg |
| índice de refração |
1.626 |
| O ponto de inflamação |
131.1°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
