ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
| Nome do produto |
2-Bromo-6-fluorotoluene |
| Sinônimos |
Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
| Fórmula molecular |
C7H4ClFN2S |
| Peso Molecular |
202.6365 |
| InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| CAS Registry Number |
1422-54-4 |
| Estrutura Molecular |
|
| Densidade |
1.63g/cm3 |
| Ponto de ebulição |
294°C at 760 mmHg |
| índice de refração |
1.714 |
| O ponto de inflamação |
131.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
