ChemNet > CAS > 14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
| Nome do produto |
4-hydrazino-2,6-dimethylpyrimidine |
| Sinônimos |
4-hydrazinyl-2,6-dimethylpyrimidine; (1S)-1-phenylpropan-1-ol |
| Fórmula molecular |
C9H12O |
| Peso Molecular |
136.191 |
| InChI |
InChI=1/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1 |
| CAS Registry Number |
14331-56-7 |
| EINECS |
202-256-0 |
| Estrutura Molecular |
|
| Densidade |
0.994g/cm3 |
| Ponto de fusão |
182℃ |
| Ponto de ebulição |
219°C at 760 mmHg |
| índice de refração |
1.524 |
| O ponto de inflamação |
97.3°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
|
|
