ChemNet > CAS > 145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
| Nome do produto |
Methyl 2,5-dichlorothiophene-3-carboxylate |
| Sinônimos |
2,5-Dichlorothiophene-3-carboxylic acid methyl ester |
| Fórmula molecular |
C6H4Cl2O2S |
| Peso Molecular |
211.0658 |
| InChI |
InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3 |
| CAS Registry Number |
145129-54-0 |
| Estrutura Molecular |
|
| Densidade |
1.5g/cm3 |
| Ponto de ebulição |
257.3°C at 760 mmHg |
| índice de refração |
1.57 |
| O ponto de inflamação |
109.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
