ChemNet > CAS > 145349-76-4 4-(Ethylthio)benzeneboronic acid
145349-76-4 4-(Ethylthio)benzeneboronic acid
| Nome do produto |
4-(Ethylthio)benzeneboronic acid |
| Sinônimos |
4-(Ethylthio)phenylboronic acid; [4-(ethylsulfanyl)phenyl]boronic acid; 4-Ethylthiophenylboronic acid |
| Fórmula molecular |
C8H11BO2S |
| Peso Molecular |
182.0477 |
| InChI |
InChI=1/C8H11BO2S/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6,10-11H,2H2,1H3 |
| CAS Registry Number |
145349-76-4 |
| Estrutura Molecular |
|
| Densidade |
1.18g/cm3 |
| Ponto de ebulição |
343.5°C at 760 mmHg |
| índice de refração |
1.571 |
| O ponto de inflamação |
161.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
