ChemNet > CAS > 1785-61-1 m-Diethynylbenzene
1785-61-1 m-Diethynylbenzene
| Nome do produto |
m-Diethynylbenzene |
| Sinônimos |
1,3-Diethynylbenzene |
| Fórmula molecular |
C10H6 |
| Peso Molecular |
126.1546 |
| InChI |
InChI=1/C10H6/c1-3-9-6-5-7-10(4-2)8-9/h1-2,5-8H |
| CAS Registry Number |
1785-61-1 |
| Estrutura Molecular |
|
| Densidade |
1g/cm3 |
| Ponto de ebulição |
206.9°C at 760 mmHg |
| índice de refração |
1.567 |
| O ponto de inflamação |
66.5°C |
| Símbolos de perigo |
|
| Códigos de risco |
R10:Flammable.;
|
| Descrição da Segurança |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
