ChemNet > CAS > 19056-40-7 4-Bromo-3-methoxyaniline
19056-40-7 4-Bromo-3-methoxyaniline
| Nome do produto |
4-Bromo-3-methoxyaniline |
| Sinônimos |
4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
| Fórmula molecular |
C13H10N2O4 |
| Peso Molecular |
258.2295 |
| InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
| CAS Registry Number |
19056-40-7 |
| Estrutura Molecular |
|
| Densidade |
1.381g/cm3 |
| Ponto de ebulição |
467°C at 760 mmHg |
| índice de refração |
1.655 |
| O ponto de inflamação |
236.2°C |
| Símbolos de perigo |
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
