ChemNet > CAS > 19847-10-0 2-Pyrazinecarbonyl chloride
19847-10-0 2-Pyrazinecarbonyl chloride
| Nome do produto |
2-Pyrazinecarbonyl chloride |
| Sinônimos |
Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
| Fórmula molecular |
C5H3ClN2O |
| Peso Molecular |
142.5431 |
| InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
| CAS Registry Number |
19847-10-0 |
| EINECS |
243-367-4 |
| Estrutura Molecular |
|
| Densidade |
1.393g/cm3 |
| Ponto de fusão |
40.9℃ |
| Ponto de ebulição |
214.5°C at 760 mmHg |
| índice de refração |
1.551 |
| O ponto de inflamação |
83.5°C |
| Símbolos de perigo |
 C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
