ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
| Nome do produto |
2-Bromo-4-fluoro-1-iodobenzene |
| Sinônimos |
2-Bromo-4-fluoroiodobenzene |
| Fórmula molecular |
C6H3BrFI |
| Peso Molecular |
300.8949 |
| InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| CAS Registry Number |
202865-73-4 |
| Estrutura Molecular |
|
| Densidade |
2.281g/cm3 |
| Ponto de ebulição |
243.2°C at 760 mmHg |
| índice de refração |
1.628 |
| O ponto de inflamação |
100.9°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
