ChemNet > CAS > 2103-88-0 2-Mercapto-4-phenylthiazole
2103-88-0 2-Mercapto-4-phenylthiazole
| Nome do produto |
2-Mercapto-4-phenylthiazole |
| Sinônimos |
4-Phenyl-2-thiazolethiol; 4-phenyl-1,3-thiazole-2(3H)-thione |
| Fórmula molecular |
C9H7NS2 |
| Peso Molecular |
193.2886 |
| InChI |
InChI=1/C9H7NS2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
| CAS Registry Number |
2103-88-0 |
| EINECS |
218-274-7 |
| Estrutura Molecular |
|
| Densidade |
1.37g/cm3 |
| Ponto de ebulição |
333.1°C at 760 mmHg |
| índice de refração |
1.744 |
| O ponto de inflamação |
155.2°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
