ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
| Nome do produto |
3,4,5-trifluoroacetophenone |
| Sinônimos |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
| Fórmula molecular |
C8H5F3O |
| Peso Molecular |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| CAS Registry Number |
220141-73-1 |
| Estrutura Molecular |
|
| Densidade |
1.303g/cm3 |
| Ponto de ebulição |
208.8°C at 760 mmHg |
| índice de refração |
1.455 |
| O ponto de inflamação |
72.5°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
