ChemNet > CAS > 2246-46-0 4-(2-Thiazolylazo)resorcinol
2246-46-0 4-(2-Thiazolylazo)resorcinol
| Nome do produto |
4-(2-Thiazolylazo)resorcinol |
| Sinônimos |
3-hydroxy-4-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,5-dien-1-one |
| Fórmula molecular |
C9H7N3O2S |
| Peso Molecular |
221.2358 |
| InChI |
InChI=1/C9H7N3O2S/c13-6-1-2-7(8(14)5-6)11-12-9-10-3-4-15-9/h1-5,14H,(H,10,12) |
| CAS Registry Number |
2246-46-0 |
| EINECS |
218-836-1 |
| Estrutura Molecular |
|
| Densidade |
1.53g/cm3 |
| Ponto de fusão |
205-210℃ |
| Ponto de ebulição |
402.9°C at 760 mmHg |
| índice de refração |
1.734 |
| O ponto de inflamação |
197.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
