ChemNet > CAS > 2254-94-6 N-Methylbenzothiazole-2-thione
2254-94-6 N-Methylbenzothiazole-2-thione
| Nome do produto |
N-Methylbenzothiazole-2-thione |
| Sinônimos |
3-Methylbenzothiazole-2-thione; 3-methyl-1,3-benzothiazole-2(3H)-thione |
| Fórmula molecular |
C8H7NS2 |
| Peso Molecular |
181.2779 |
| InChI |
InChI=1/C8H7NS2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h2-5H,1H3 |
| CAS Registry Number |
2254-94-6 |
| EINECS |
218-852-9 |
| Estrutura Molecular |
|
| Densidade |
1.39g/cm3 |
| Ponto de fusão |
88-91℃ |
| Ponto de ebulição |
300.6°C at 760 mmHg |
| índice de refração |
1.753 |
| O ponto de inflamação |
135.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
