ChemNet > CAS > 229-87-8 Phenanthridine
229-87-8 Phenanthridine
| Nome do produto |
Phenanthridine |
| Sinônimos |
Phenanthridine; 3,4-Benzoquinoline; Phenanthridine, (Benzo[c]quinoline) |
| Fórmula molecular |
C13H9N |
| Peso Molecular |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
| CAS Registry Number |
229-87-8 |
| EINECS |
205-934-4 |
| Estrutura Molecular |
|
| Densidade |
1.187g/cm3 |
| Ponto de fusão |
104-107℃ |
| Ponto de ebulição |
340.8°C at 760 mmHg |
| índice de refração |
1.726 |
| O ponto de inflamação |
155.9°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R40:Possible risks of irreversible effects.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
