ChemNet > CAS > 2350-89-2 4-Vinylbiphenyl
2350-89-2 4-Vinylbiphenyl
| Nome do produto |
4-Vinylbiphenyl |
| Sinônimos |
4-Phenylstyrene; 4-ethenylbiphenyl |
| Fórmula molecular |
C14H12 |
| Peso Molecular |
180.2451 |
| InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
| CAS Registry Number |
2350-89-2 |
| EINECS |
219-082-6 |
| Estrutura Molecular |
|
| Densidade |
0.997g/cm3 |
| Ponto de fusão |
115-121℃ |
| Ponto de ebulição |
301.7°C at 760 mmHg |
| índice de refração |
1.599 |
| O ponto de inflamação |
139.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
