ChemNet > CAS > 2571-52-0 Mesitonitrile
2571-52-0 Mesitonitrile
| Nome do produto |
Mesitonitrile |
| Sinônimos |
2,4,6-Trimethylbenzonitrile; Cyanomesitylene |
| Fórmula molecular |
C10H11N |
| Peso Molecular |
145.201 |
| InChI |
InChI=1/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
| CAS Registry Number |
2571-52-0 |
| Estrutura Molecular |
|
| Densidade |
0.97g/cm3 |
| Ponto de ebulição |
260.3°C at 760 mmHg |
| índice de refração |
1.521 |
| O ponto de inflamação |
111.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
