ChemNet > CAS > 27829-72-7 ethyl trans-2-hexenoate
27829-72-7 ethyl trans-2-hexenoate
| Nome do produto |
ethyl trans-2-hexenoate |
| Sinônimos |
trans-2-Hexenoic acid ethyl ester; ethyl (2E)-hex-2-enoate; Ethyl (E)-Hex-2-Enoate |
| Fórmula molecular |
C8H14O2 |
| Peso Molecular |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
| CAS Registry Number |
27829-72-7 |
| EINECS |
248-681-5 |
| Estrutura Molecular |
|
| Densidade |
0.901g/cm3 |
| Ponto de ebulição |
172.6°C at 760 mmHg |
| índice de refração |
1.432 |
| O ponto de inflamação |
62.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
