ChemNet > CAS > 3147-50-0 2,6-Dihydroxybenzamide
3147-50-0 2,6-Dihydroxybenzamide
| Nome do produto |
2,6-Dihydroxybenzamide |
| Fórmula molecular |
C7H7NO3 |
| Peso Molecular |
153.1354 |
| InChI |
InChI=1/C7H7NO3/c8-7(11)6-4(9)2-1-3-5(6)10/h1-3,9-10H,(H2,8,11) |
| CAS Registry Number |
3147-50-0 |
| EINECS |
221-568-8 |
| Estrutura Molecular |
|
| Densidade |
1.458g/cm3 |
| Ponto de ebulição |
357.6°C at 760 mmHg |
| índice de refração |
1.664 |
| O ponto de inflamação |
170.1°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
