ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
| Nome do produto |
3-fluoro-4-methoxybenzonitrile |
| Sinônimos |
Fluoromethoxybenzonitrile |
| Fórmula molecular |
C8H6FNO |
| Peso Molecular |
151.1377 |
| InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| CAS Registry Number |
331-62-4 |
| Estrutura Molecular |
|
| Densidade |
1.18g/cm3 |
| Ponto de ebulição |
254.3°C at 760 mmHg |
| índice de refração |
1.505 |
| O ponto de inflamação |
107.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
