ChemNet > CAS > 3325-11-9 5-Aminobenzotriazole
3325-11-9 5-Aminobenzotriazole
| Nome do produto |
5-Aminobenzotriazole |
| Sinônimos |
1H-Benzotriazol-6-amine; 1H-Benzotriazol-5-amine; 2H-benzotriazol-5-amine |
| Fórmula molecular |
C6H6N4 |
| Peso Molecular |
134.1386 |
| InChI |
InChI=1/C6H6N4/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H,7H2,(H,8,9,10) |
| CAS Registry Number |
3325-11-9 |
| Estrutura Molecular |
|
| Densidade |
1.48g/cm3 |
| Ponto de ebulição |
387.4°C at 760 mmHg |
| índice de refração |
1.806 |
| O ponto de inflamação |
216.5°C |
| Símbolos de perigo |
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
