ChemNet > CAS > 34824-58-3 2-Bromophenyldioxolane
34824-58-3 2-Bromophenyldioxolane
| Nome do produto |
2-Bromophenyldioxolane |
| Sinônimos |
2-(2-Bromophenyl)-1,3-dioxolane; 2-Bromobenzaldehyde ethylene acetal |
| Fórmula molecular |
C9H9BrO2 |
| Peso Molecular |
229.0706 |
| InChI |
InChI=1/C9H9BrO2/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h1-4,9H,5-6H2 |
| CAS Registry Number |
34824-58-3 |
| Estrutura Molecular |
|
| Densidade |
1.515g/cm3 |
| Ponto de ebulição |
272.1°C at 760 mmHg |
| índice de refração |
1.564 |
| O ponto de inflamação |
120.8°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
