ChemNet > CAS > 4144-62-1 5-Benzoylpentanoic acid
4144-62-1 5-Benzoylpentanoic acid
| Nome do produto |
5-Benzoylpentanoic acid |
| Sinônimos |
6-Oxo-6-phenylhexanoic acid |
| Fórmula molecular |
C12H14O3 |
| Peso Molecular |
206.2378 |
| InChI |
InChI=1/C12H14O3/c13-11(8-4-5-9-12(14)15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15) |
| CAS Registry Number |
4144-62-1 |
| Estrutura Molecular |
|
| Densidade |
1.135g/cm3 |
| Ponto de ebulição |
385.3°C at 760 mmHg |
| índice de refração |
1.533 |
| O ponto de inflamação |
201°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
