ChemNet > CAS > 423768-52-9 (1,5-dimethyl-1H-pyrazol-3-yl)methylamine
423768-52-9 (1,5-dimethyl-1H-pyrazol-3-yl)methylamine
| Nome do produto |
(1,5-dimethyl-1H-pyrazol-3-yl)methylamine |
| Sinônimos |
1-(1,5-dimethyl-1H-pyrazol-3-yl)methanamine; (1,5-dimethyl-1H-pyrazol-3-yl)methanamine |
| Fórmula molecular |
C6H11N3 |
| Peso Molecular |
125.1716 |
| InChI |
InChI=1/C6H11N3/c1-5-3-6(4-7)8-9(5)2/h3H,4,7H2,1-2H3 |
| CAS Registry Number |
423768-52-9 |
| Estrutura Molecular |
|
| Densidade |
1.12g/cm3 |
| Ponto de ebulição |
229.3°C at 760 mmHg |
| índice de refração |
1.566 |
| O ponto de inflamação |
92.5°C |
| Símbolos de perigo |
 C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
