ChemNet > CAS > 423768-54-1 2-morpholinonicotinic acid
423768-54-1 2-morpholinonicotinic acid
| Nome do produto |
2-morpholinonicotinic acid |
| Sinônimos |
2-morpholin-4-ylpyridine-3-carboxylic acid |
| Fórmula molecular |
C10H12N2O3 |
| Peso Molecular |
208.2139 |
| InChI |
InChI=1/C10H12N2O3/c13-10(14)8-2-1-3-11-9(8)12-4-6-15-7-5-12/h1-3H,4-7H2,(H,13,14) |
| CAS Registry Number |
423768-54-1 |
| Estrutura Molecular |
|
| Densidade |
1.313g/cm3 |
| Ponto de fusão |
130℃ |
| Ponto de ebulição |
418°C at 760 mmHg |
| índice de refração |
1.584 |
| O ponto de inflamação |
206.6°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
