ChemNet > CAS > 42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
| Nome do produto |
5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| Sinônimos |
3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| Fórmula molecular |
C10H7ClN4 |
| Peso Molecular |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
| CAS Registry Number |
42754-62-1 |
| Estrutura Molecular |
|
| Densidade |
1.48g/cm3 |
| Ponto de fusão |
212℃ |
| Ponto de ebulição |
554.7°C at 760 mmHg |
| índice de refração |
1.688 |
| O ponto de inflamação |
289.3°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
|
|
