ChemNet > CAS > 4521-33-9 5-Nitrothiophene-2-carboxaldehyde
4521-33-9 5-Nitrothiophene-2-carboxaldehyde
| Nome do produto |
5-Nitrothiophene-2-carboxaldehyde |
| Sinônimos |
5-Nitrothiophene-2-carbaldehyde |
| Fórmula molecular |
C5H3NO3S |
| Peso Molecular |
157.1472 |
| InChI |
InChI=1/C5H3NO3S/c7-3-4-1-2-5(10-4)6(8)9/h1-3H |
| CAS Registry Number |
4521-33-9 |
| EINECS |
224-850-9 |
| Estrutura Molecular |
|
| Densidade |
1.534g/cm3 |
| Ponto de ebulição |
297.2°C at 760 mmHg |
| índice de refração |
1.662 |
| O ponto de inflamação |
133.5°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
