ChemNet > CAS > 459-59-6 4-Fluoro-N-methylaniline
459-59-6 4-Fluoro-N-methylaniline
| Nome do produto |
4-Fluoro-N-methylaniline |
| Sinônimos |
4-Fluoro-N-toluidine |
| Fórmula molecular |
C7H8FN |
| Peso Molecular |
125.1435 |
| InChI |
InChI=1/C7H8FN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| CAS Registry Number |
459-59-6 |
| EINECS |
207-294-1 |
| Estrutura Molecular |
|
| Densidade |
1.106g/cm3 |
| Ponto de ebulição |
181.4°C at 760 mmHg |
| índice de refração |
1.546 |
| O ponto de inflamação |
63.5°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
