ChemNet > CAS > 50-66-8 6-(Methylthio)purine
50-66-8 6-(Methylthio)purine
| Nome do produto |
6-(Methylthio)purine |
| Sinônimos |
6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
| Fórmula molecular |
C6H6N4S |
| Peso Molecular |
166.2036 |
| InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
| CAS Registry Number |
50-66-8 |
| EINECS |
200-057-3 |
| Estrutura Molecular |
|
| Densidade |
1.59g/cm3 |
| Ponto de fusão |
221-222℃ |
| Ponto de ebulição |
290.9°C at 760 mmHg |
| índice de refração |
1.806 |
| O ponto de inflamação |
129.7°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
