ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
| Nome do produto |
Diphenylborinic acid 2-aminoethyl ester |
| Sinônimos |
2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
| Fórmula molecular |
C14H16BNO |
| Peso Molecular |
225.0939 |
| InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| CAS Registry Number |
524-95-8 |
| EINECS |
208-366-5 |
| Estrutura Molecular |
|
| Densidade |
1.04g/cm3 |
| Ponto de fusão |
190-194℃ |
| Ponto de ebulição |
325.3°C at 760 mmHg |
| índice de refração |
1.559 |
| O ponto de inflamação |
150.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
