ChemNet > CAS > 5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
5393-99-7 4,5-Diphenyl-1,2,3-thiadiazole
| Nome do produto |
4,5-Diphenyl-1,2,3-thiadiazole |
| Fórmula molecular |
C14H10N2S |
| Peso Molecular |
238.3076 |
| InChI |
InChI=1/C14H10N2S/c1-3-7-11(8-4-1)13-14(17-16-15-13)12-9-5-2-6-10-12/h1-10H |
| CAS Registry Number |
5393-99-7 |
| Estrutura Molecular |
|
| Densidade |
1.216g/cm3 |
| Ponto de ebulição |
361.2°C at 760 mmHg |
| índice de refração |
1.633 |
| O ponto de inflamação |
161.9°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
